CAS 1020149-73-8 appears in our catalog under these names: SGI-1027, >95% (HPLC), SGI–1027, SGI-1027/ 99.18% (existing batch purity), SGI-1027, SGI-1027 98%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 10mg, 1mg, 5mg, 100mg, 10mM (in 1ml dmso), 25mg, 50mg, 500mg.
N-[4-[(2-amino-6-methylpyrimidin-4-yl)amino]phenyl]-4-(quinolin-4-ylamino)benzamide (CAS 1020149-73-8) is a chemical compound with the molecular formula C27H23N7O and a molecular weight of 461.5 g/mol. IUPAC name: N-[4-[(2-amino-6-methylpyrimidin-4-yl)amino]phenyl]-4-(quinolin-4-ylamino)benzamide. InChIKey: QSYLKMKIVWJAAK-UHFFFAOYSA-N.
| Molecular formula | C27H23N7O |
|---|---|
| Molecular weight | 461.5 g/mol |
| IUPAC name | N-[4-[(2-amino-6-methylpyrimidin-4-yl)amino]phenyl]-4-(quinolin-4-ylamino)benzamide |
| InChIKey | QSYLKMKIVWJAAK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N)NC2=CC=C(C=C2)NC(=O)C3=CC=C(C=C3)NC4=CC=NC5=CC=CC=C54 |
Computed by PubChem (NCBI)