CAS 1456632-40-8 appears in our catalog under these names: SH–4–54, SH-4-54/ 99.12% (existing batch purity), SH-4-54 98%, SH-4-54, 98%, 98%, SH-4-54, 99.80%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 1mg, 2mg, 10mg, 50mg.
4-[(4-cyclohexylphenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid (CAS 1456632-40-8) is a chemical compound with the molecular formula C29H27F5N2O5S and a molecular weight of 610.6 g/mol. IUPAC name: 4-[(4-cyclohexylphenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid. InChIKey: VFPYGNNOSJWBHF-UHFFFAOYSA-N.
| Molecular formula | C29H27F5N2O5S |
|---|---|
| Molecular weight | 610.6 g/mol |
| IUPAC name | 4-[(4-cyclohexylphenyl)methyl-[2-[methyl-(2,3,4,5,6-pentafluorophenyl)sulfonylamino]acetyl]amino]benzoic acid |
| InChIKey | VFPYGNNOSJWBHF-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)N(CC1=CC=C(C=C1)C2CCCCC2)C3=CC=C(C=C3)C(=O)O)S(=O)(=O)C4=C(C(=C(C(=C4F)F)F)F)F |
Computed by PubChem (NCBI)