CAS 2252247-80-4 appears in our catalog under these names: SHIP2-IN-1/ 99.16% (existing batch purity), SHIP2–IN–1, SHIP2-IN-1 98+%, SHIP2-IN-1, SHIP2-IN-1, 99.72%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
5-[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrimidin-2-amine (CAS 2252247-80-4) is a chemical compound with the molecular formula C17H13Cl2FN4O and a molecular weight of 379.2 g/mol. IUPAC name: 5-[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrimidin-2-amine. InChIKey: ATPYDXUUBCDYKQ-SECBINFHSA-N.
| Molecular formula | C17H13Cl2FN4O |
|---|---|
| Molecular weight | 379.2 g/mol |
| IUPAC name | 5-[5-[(1R)-1-(2,6-dichloro-3-fluorophenyl)ethoxy]-3-pyridinyl]pyrimidin-2-amine |
| InChIKey | ATPYDXUUBCDYKQ-SECBINFHSA-N |
| SMILES | C[C@H](C1=C(C=CC(=C1Cl)F)Cl)OC2=CN=CC(=C2)C3=CN=C(N=C3)N |
Computed by PubChem (NCBI)