CAS 2765625-93-0 appears in our catalog under these names: SJ6986, SJ6986/ 99.45% (existing batch purity), SJ6986, 98%, 98%, SJ6986, 98.35%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 500mg, 250mg, 50 mg.
N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-(trifluoromethoxy)benzenesulfonamide (CAS 2765625-93-0) is a chemical compound with the molecular formula C20H14F3N3O7S and a molecular weight of 497.4 g/mol. IUPAC name: N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-(trifluoromethoxy)benzenesulfonamide. InChIKey: RKAFYSIKAVFVPS-UHFFFAOYSA-N.
| Molecular formula | C20H14F3N3O7S |
|---|---|
| Molecular weight | 497.4 g/mol |
| IUPAC name | N-[2-(2,6-dioxopiperidin-3-yl)-1,3-dioxoisoindol-5-yl]-2-(trifluoromethoxy)benzenesulfonamide |
| InChIKey | RKAFYSIKAVFVPS-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C2=O)C=C(C=C3)NS(=O)(=O)C4=CC=CC=C4OC(F)(F)F |
Computed by PubChem (NCBI)