CAS 63388-44-3 appears in our catalog under these names: SJB2-043/ 99.35% (existing batch purity), SJB2–043, SJB2-043, SJB2-043 98%, SJB2-043, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 2mg.
2-phenylbenzo[f][1,3]benzoxazole-4,9-dione (CAS 63388-44-3) is a chemical compound with the molecular formula C17H9NO3 and a molecular weight of 275.26 g/mol. IUPAC name: 2-phenylbenzo[f][1,3]benzoxazole-4,9-dione. InChIKey: CMYQQADDUUDCCA-UHFFFAOYSA-N.
| Molecular formula | C17H9NO3 |
|---|---|
| Molecular weight | 275.26 g/mol |
| IUPAC name | 2-phenylbenzo[f][1,3]benzoxazole-4,9-dione |
| InChIKey | CMYQQADDUUDCCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(O2)C(=O)C4=CC=CC=C4C3=O |
Computed by PubChem (NCBI)