Products 1218816-71-7
CAS 1218816-71-7 appears in our catalog under these names: SK1-IN-1, 98%, SK1-IN-1/ 98.72% (existing batch purity), SK1-IN-1, SK1-IN-1, 98.10%, SK1-IN-1 (Standard). Offered by: AmBeed, TargetMol, Chemat, MedChemExpress. Available pack sizes: 100mg, 1mg, 5mg, 10mg, 25 mg, 5 mg, 50 mg, 10mM/1mL.
(2S,3S)-N-[(1S)-1-[4-[5-(2-cyclopentylethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]-3-hydroxypyrrolidine-2-carboxamide (CAS 1218816-71-7) is a chemical compound with the molecular formula C22H30N4O3 and a molecular weight of 398.5 g/mol. IUPAC name: (2S,3S)-N-[(1S)-1-[4-[5-(2-cyclopentylethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]-3-hydroxypyrrolidine-2-carboxamide. InChIKey: GDJANRNMFHNVOW-DCPHZVHLSA-N.
| Molecular formula | C22H30N4O3 |
|---|---|
| Molecular weight | 398.5 g/mol |
| IUPAC name | (2S,3S)-N-[(1S)-1-[4-[5-(2-cyclopentylethyl)-1,2,4-oxadiazol-3-yl]phenyl]ethyl]-3-hydroxypyrrolidine-2-carboxamide |
| InChIKey | GDJANRNMFHNVOW-DCPHZVHLSA-N |
| SMILES | C[C@@H](C1=CC=C(C=C1)C2=NOC(=N2)CCC3CCCC3)NC(=O)[C@@H]4[C@H](CCN4)O |
Computed by PubChem (NCBI)
Synonyms:
orb1708515