CAS 2285432-57-5 appears in our catalog under these names: SLU–PP–1072, SLU-PP-1072/ 98.1% (existing batch purity), SLU-PP-1072 98%, SLU-PP-1072, SLU-PP-1072, 98.24%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 500mg, 25 mg.
N-(1,3-benzothiazol-6-yl)-5-(4-hydroxyphenyl)furan-2-carboxamide (CAS 2285432-57-5) is a chemical compound with the molecular formula C18H12N2O3S and a molecular weight of 336.4 g/mol. IUPAC name: N-(1,3-benzothiazol-6-yl)-5-(4-hydroxyphenyl)furan-2-carboxamide. InChIKey: DYMDZGMAYKMYCT-UHFFFAOYSA-N.
| Molecular formula | C18H12N2O3S |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | N-(1,3-benzothiazol-6-yl)-5-(4-hydroxyphenyl)furan-2-carboxamide |
| InChIKey | DYMDZGMAYKMYCT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CC=C(O2)C(=O)NC3=CC4=C(C=C3)N=CS4)O |
Computed by PubChem (NCBI)