CAS 6266-54-2 appears in our catalog under these names: SM27/ 98.83% (existing batch purity), 6,6'-(Carbonylbis(azanediyl))bis(4-hydroxynaphthalene-2-sulfonic acid), SM27. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 1 mg.
4-hydroxy-6-[(8-hydroxy-6-sulfonaphthalen-2-yl)carbamoylamino]naphthalene-2-sulfonic acid (CAS 6266-54-2) is a chemical compound with the molecular formula C21H16N2O9S2 and a molecular weight of 504.5 g/mol. IUPAC name: 4-hydroxy-6-[(8-hydroxy-6-sulfonaphthalen-2-yl)carbamoylamino]naphthalene-2-sulfonic acid. InChIKey: XUMPVMRAPYSHRQ-UHFFFAOYSA-N.
| Molecular formula | C21H16N2O9S2 |
|---|---|
| Molecular weight | 504.5 g/mol |
| IUPAC name | 4-hydroxy-6-[(8-hydroxy-6-sulfonaphthalen-2-yl)carbamoylamino]naphthalene-2-sulfonic acid |
| InChIKey | XUMPVMRAPYSHRQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)O)O)NC(=O)NC3=CC4=C(C=C(C=C4C=C3)S(=O)(=O)O)O |
Computed by PubChem (NCBI)