CAS 432020-20-7 appears in our catalog under these names: SMI481/ 99.54% (existing batch purity), SMI–481, SMI-481, NPPM 6748-481, 99.60%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg, 500mg.
(4-chloro-3-nitrophenyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone (CAS 432020-20-7) is a chemical compound with the molecular formula C17H15ClFN3O3 and a molecular weight of 363.8 g/mol. IUPAC name: (4-chloro-3-nitrophenyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone. InChIKey: LSPJXCGEFJDMHA-UHFFFAOYSA-N.
| Molecular formula | C17H15ClFN3O3 |
|---|---|
| Molecular weight | 363.8 g/mol |
| IUPAC name | (4-chloro-3-nitrophenyl)-[4-(2-fluorophenyl)piperazin-1-yl]methanone |
| InChIKey | LSPJXCGEFJDMHA-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=CC=C2F)C(=O)C3=CC(=C(C=C3)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)