CAS 1822355-27-0 appears in our catalog under these names: SMO-IN-2/ 98.64% (existing batch purity), SMO–IN–2, SMO-IN-2, 98%, 98%, SMO-IN-2, 98.12%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
4-fluoro-N-methyl-N-[1-[2-[(2-methylpyrazol-3-yl)amino]benzoyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide (CAS 1822355-27-0) is a chemical compound with the molecular formula C25H25F4N5O2 and a molecular weight of 503.5 g/mol. IUPAC name: 4-fluoro-N-methyl-N-[1-[2-[(2-methylpyrazol-3-yl)amino]benzoyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide. InChIKey: DGYPDRAGFZNVOC-UHFFFAOYSA-N.
| Molecular formula | C25H25F4N5O2 |
|---|---|
| Molecular weight | 503.5 g/mol |
| IUPAC name | 4-fluoro-N-methyl-N-[1-[2-[(2-methylpyrazol-3-yl)amino]benzoyl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
| InChIKey | DGYPDRAGFZNVOC-UHFFFAOYSA-N |
| SMILES | CN1C(=CC=N1)NC2=CC=CC=C2C(=O)N3CCC(CC3)N(C)C(=O)C4=C(C=C(C=C4)F)C(F)(F)F |
Computed by PubChem (NCBI)