CAS 1807943-38-9 appears in our catalog under these names: SMS1-IN-1/ 99.59% (existing batch purity), SMS1–IN–1, SMS1-IN-1, N-[(4-Bromophenyl)methyl]-2-[4-[[(2-phenylethyl)amino]sulfonyl]phenoxy]acetamide, 99%, 99%, SMS1-IN-1, 99.44%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 25 mg.
N-[(4-bromophenyl)methyl]-2-[4-(2-phenylethylsulfamoyl)phenoxy]acetamide (CAS 1807943-38-9) is a chemical compound with the molecular formula C23H23BrN2O4S and a molecular weight of 503.4 g/mol. IUPAC name: N-[(4-bromophenyl)methyl]-2-[4-(2-phenylethylsulfamoyl)phenoxy]acetamide. InChIKey: CZAFIFBJBFDMTP-UHFFFAOYSA-N.
| Molecular formula | C23H23BrN2O4S |
|---|---|
| Molecular weight | 503.4 g/mol |
| IUPAC name | N-[(4-bromophenyl)methyl]-2-[4-(2-phenylethylsulfamoyl)phenoxy]acetamide |
| InChIKey | CZAFIFBJBFDMTP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCNS(=O)(=O)C2=CC=C(C=C2)OCC(=O)NCC3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)