CAS 727699-84-5 appears in our catalog under these names: SN-001/ 99.51% (existing batch purity), SN–001, N-(3-(4-Fluorobenzenesulfonamido)-4-methoxyphenyl)-4-phenylbenzamide, SN-001 95%, N-(3-(4-Fluorophenylsulfonamido)-4-methoxyphenyl)-[1,1'-biphenyl]-4-carboxamide, 95%, 95%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 500mg, 0,5g.
N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-4-phenylbenzamide (CAS 727699-84-5) is a chemical compound with the molecular formula C26H21FN2O4S and a molecular weight of 476.5 g/mol. IUPAC name: N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-4-phenylbenzamide. InChIKey: DVLMVJILWFSRPS-UHFFFAOYSA-N.
| Molecular formula | C26H21FN2O4S |
|---|---|
| Molecular weight | 476.5 g/mol |
| IUPAC name | N-[3-[(4-fluorophenyl)sulfonylamino]-4-methoxyphenyl]-4-phenylbenzamide |
| InChIKey | DVLMVJILWFSRPS-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)C3=CC=CC=C3)NS(=O)(=O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)