CAS 2249106-01-0 appears in our catalog under these names: SN-008/ 96.83% (existing batch purity), SN–008, SN-008, SN-008, 99.68%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM/1mL.
N-[3-[(4-fluorophenyl)sulfonylamino]phenyl]-4-phenylbenzamide (CAS 2249106-01-0) is a chemical compound with the molecular formula C25H19FN2O3S and a molecular weight of 446.5 g/mol. IUPAC name: N-[3-[(4-fluorophenyl)sulfonylamino]phenyl]-4-phenylbenzamide. InChIKey: GFQARWFKDMDSAS-UHFFFAOYSA-N.
| Molecular formula | C25H19FN2O3S |
|---|---|
| Molecular weight | 446.5 g/mol |
| IUPAC name | N-[3-[(4-fluorophenyl)sulfonylamino]phenyl]-4-phenylbenzamide |
| InChIKey | GFQARWFKDMDSAS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)NC3=CC(=CC=C3)NS(=O)(=O)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)