Products 1073969-18-2
CAS 1073969-18-2 appears in our catalog under these names: SNX0723/ 99.86% (existing batch purity), SNX–0723, SNX-0723, SNX-0723, 99.12%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 200mg.
2-fluoro-6-[[(3S)-oxolan-3-yl]amino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide (CAS 1073969-18-2) is a chemical compound with the molecular formula C22H26FN3O3 and a molecular weight of 399.5 g/mol. IUPAC name: 2-fluoro-6-[[(3S)-oxolan-3-yl]amino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide. InChIKey: GAGDTKJJVCLACJ-ZDUSSCGKSA-N.
| Molecular formula | C22H26FN3O3 |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | 2-fluoro-6-[[(3S)-oxolan-3-yl]amino]-4-(3,6,6-trimethyl-4-oxo-5,7-dihydroindol-1-yl)benzamide |
| InChIKey | GAGDTKJJVCLACJ-ZDUSSCGKSA-N |
| SMILES | CC1=CN(C2=C1C(=O)CC(C2)(C)C)C3=CC(=C(C(=C3)F)C(=O)N)N[C@H]4CCOC4 |
Computed by PubChem (NCBI)