cas: 1334177-95-5 — see every product listed under this CAS number, including other names
SPDP-PEG4-NHS ester, 98% (CAS 1334177-95-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F554632-25MG |
| cas | 1334177-95-5 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25mg | 622.72 Pln | |
| Fluorochem | 50mg | 955.93 Pln | |
| Fluorochem | 100mg | 1044.44 Pln | |
| Fluorochem | 250mg | 2361.69 Pln | |
| Fluorochem | 1g | 6266.56 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1334177-95-5) is a chemical compound with the molecular formula C23H33N3O9S2 and a molecular weight of 559.7 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: QTVBGVZVUCIFAH-UHFFFAOYSA-N.
| Molecular formula | C23H33N3O9S2 |
|---|---|
| Molecular weight | 559.7 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-(pyridin-2-yldisulfanyl)propanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | QTVBGVZVUCIFAH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)CCSSC2=CC=CC=N2 |
Computed by PubChem (NCBI)