cas: 1246525-60-9 — see every product listed under this CAS number, including other names
SR-1078, 99%, 99% (CAS 1246525-60-9) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 1mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BPC-5mg |
| cas | 1246525-60-9 |
| size | 5mg |
| availability | 2g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 117.20 Pln | |
| Chemat | 10mg | 126.80 Pln | |
| Chemat | 25mg | 194.00 Pln | |
| Chemat | 50mg | 275.60 Pln | |
| Chemat | 100mg | 414.80 Pln | |
| Chemat | 250mg | 774.80 Pln | |
| Chemat | 1g | 1907.60 Pln | |
| Chemat | 1mg | 83.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-(trifluoromethyl)benzamide (CAS 1246525-60-9) is a chemical compound with the molecular formula C17H10F9NO2 and a molecular weight of 431.25 g/mol. IUPAC name: N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-(trifluoromethyl)benzamide. InChIKey: DUXWIYXHHGNUJU-UHFFFAOYSA-N.
| Molecular formula | C17H10F9NO2 |
|---|---|
| Molecular weight | 431.25 g/mol |
| IUPAC name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-(trifluoromethyl)benzamide |
| InChIKey | DUXWIYXHHGNUJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)C(C(F)(F)F)(C(F)(F)F)O)C(F)(F)F |
Computed by PubChem (NCBI)