CAS 1246525-60-9 appears in our catalog under these names: SR 1078, SR1078/ 98.74% (existing batch purity), SR1078, SR-1078 99%, ROR╬▒/╬│ Agonist, SR1078 1PC X 10MG. Offered by: TRC, TargetMol, GLPBio, Ambeed, Sigma-Aldrich. Available pack sizes: 10mg, 1mg, 5mg, 2mg, 25mg, 50mg, 100mg, 200mg.
N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-(trifluoromethyl)benzamide (CAS 1246525-60-9) is a chemical compound with the molecular formula C17H10F9NO2 and a molecular weight of 431.25 g/mol. IUPAC name: N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-(trifluoromethyl)benzamide. InChIKey: DUXWIYXHHGNUJU-UHFFFAOYSA-N.
| Molecular formula | C17H10F9NO2 |
|---|---|
| Molecular weight | 431.25 g/mol |
| IUPAC name | N-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-4-(trifluoromethyl)benzamide |
| InChIKey | DUXWIYXHHGNUJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)NC2=CC=C(C=C2)C(C(F)(F)F)(C(F)(F)F)O)C(F)(F)F |
Computed by PubChem (NCBI)