CAS 1128096-91-2 appears in our catalog under these names: SR–3306, SR-3306/ 99.81% (existing batch purity), Sr-3306, SR-3306, 99.0%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
N-[4-[3-(6-methyl-3-pyridinyl)-1,2,4-triazol-1-yl]phenyl]-4-(3-morpholin-4-ylphenyl)pyrimidin-2-amine (CAS 1128096-91-2) is a chemical compound with the molecular formula C28H26N8O and a molecular weight of 490.6 g/mol. IUPAC name: N-[4-[3-(6-methyl-3-pyridinyl)-1,2,4-triazol-1-yl]phenyl]-4-(3-morpholin-4-ylphenyl)pyrimidin-2-amine. InChIKey: QDMXVKKPYBGIAS-UHFFFAOYSA-N.
| Molecular formula | C28H26N8O |
|---|---|
| Molecular weight | 490.6 g/mol |
| IUPAC name | N-[4-[3-(6-methyl-3-pyridinyl)-1,2,4-triazol-1-yl]phenyl]-4-(3-morpholin-4-ylphenyl)pyrimidin-2-amine |
| InChIKey | QDMXVKKPYBGIAS-UHFFFAOYSA-N |
| SMILES | CC1=NC=C(C=C1)C2=NN(C=N2)C3=CC=C(C=C3)NC4=NC=CC(=N4)C5=CC(=CC=C5)N6CCOCC6 |
Computed by PubChem (NCBI)