CAS 2375421-09-1 appears in our catalog under these names: SR–717, SR-717/ 98.64% (existing batch purity), SR-717 lithium, SR-717 98%, SR-717, 99.89%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 10mM (in 1ml dmso), 2mg, 50mg, 100mg.
Lithium 4,5-difluoro-2-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate (CAS 2375421-09-1) is a chemical compound with the molecular formula C15H8F2LiN5O3 and a molecular weight of 351.2 g/mol. IUPAC name: lithium 4,5-difluoro-2-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate. InChIKey: ODSAJRWPLSVEHJ-UHFFFAOYSA-M.
| Molecular formula | C15H8F2LiN5O3 |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | lithium 4,5-difluoro-2-[(6-imidazol-1-ylpyridazine-3-carbonyl)amino]benzoate |
| InChIKey | ODSAJRWPLSVEHJ-UHFFFAOYSA-M |
| SMILES | [Li+].C1=CC(=NN=C1C(=O)NC2=CC(=C(C=C2C(=O)[O-])F)F)N3C=CN=C3 |
Computed by PubChem (NCBI)