CAS 2505001-54-5 appears in our catalog under these names: SR15006, SR15006/ 99.78% (existing batch purity), SR15006 99%, (2E)-3-(3-Chlorophenyl)-N-[2-[4-(methylsulfonyl)-1-piperazinyl]-2-oxoethyl]-2-propenamide, 99%, 99%, SR15006, 99.95%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 100 mg.
(E)-3-(3-chlorophenyl)-N-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]prop-2-enamide (CAS 2505001-54-5) is a chemical compound with the molecular formula C16H20ClN3O4S and a molecular weight of 385.9 g/mol. IUPAC name: (E)-3-(3-chlorophenyl)-N-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]prop-2-enamide. InChIKey: DURMLOBZTVQDGQ-AATRIKPKSA-N.
| Molecular formula | C16H20ClN3O4S |
|---|---|
| Molecular weight | 385.9 g/mol |
| IUPAC name | (E)-3-(3-chlorophenyl)-N-[2-(4-methylsulfonylpiperazin-1-yl)-2-oxoethyl]prop-2-enamide |
| InChIKey | DURMLOBZTVQDGQ-AATRIKPKSA-N |
| SMILES | CS(=O)(=O)N1CCN(CC1)C(=O)CNC(=O)/C=C/C2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)