CAS 2134602-45-0 appears in our catalog under these names: SR17018/ 99.73% (existing batch purity), SR17018, 5,6-Dichloro-1-[1-[(4-chlorophenyl)methyl]-4-piperidinyl]-1,3-dihydro-2H-benzimidazol-2-one, 98%, 98%, SR17018, 98.01%. Offered by: TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 50 mg, 10 mg.
5,6-dichloro-3-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-1H-benzimidazol-2-one (CAS 2134602-45-0) is a chemical compound with the molecular formula C19H18Cl3N3O and a molecular weight of 410.7 g/mol. IUPAC name: 5,6-dichloro-3-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-1H-benzimidazol-2-one. InChIKey: LAGUDYUGRSQDKS-UHFFFAOYSA-N.
| Molecular formula | C19H18Cl3N3O |
|---|---|
| Molecular weight | 410.7 g/mol |
| IUPAC name | 5,6-dichloro-3-[1-[(4-chlorophenyl)methyl]piperidin-4-yl]-1H-benzimidazol-2-one |
| InChIKey | LAGUDYUGRSQDKS-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N2C3=CC(=C(C=C3NC2=O)Cl)Cl)CC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)