CAS 167648-73-9 appears in our catalog under these names: SR4554/ 99.59% (existing batch purity), SR-4554. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, Get quote.
2-(2-nitroimidazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide (CAS 167648-73-9) is a chemical compound with the molecular formula C8H9F3N4O4 and a molecular weight of 282.18 g/mol. IUPAC name: 2-(2-nitroimidazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide. InChIKey: BTLNRJMECFTISR-UHFFFAOYSA-N.
| Molecular formula | C8H9F3N4O4 |
|---|---|
| Molecular weight | 282.18 g/mol |
| IUPAC name | 2-(2-nitroimidazol-1-yl)-N-(3,3,3-trifluoro-2-hydroxypropyl)acetamide |
| InChIKey | BTLNRJMECFTISR-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=N1)[N+](=O)[O-])CC(=O)NCC(C(F)(F)F)O |
Computed by PubChem (NCBI)