CAS 1379686-29-9 appears in our catalog under these names: SR 9011, >95% (HPLC), SR9011/ 99.6% (existing batch purity), SR9011, SR9011, 99.78%. Offered by: TRC, TargetMol, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 2,5mg, 25mg, 1mg, 2mg, 5mg, 10mg, 50mg, 100mg.
3-[[(4-chlorophenyl)methyl-[(5-nitrothiophen-2-yl)methyl]amino]methyl]-N-pentylpyrrolidine-1-carboxamide (CAS 1379686-29-9) is a chemical compound with the molecular formula C23H31ClN4O3S and a molecular weight of 479.0 g/mol. IUPAC name: 3-[[(4-chlorophenyl)methyl-[(5-nitrothiophen-2-yl)methyl]amino]methyl]-N-pentylpyrrolidine-1-carboxamide. InChIKey: PPUYOYQTTWJTIU-UHFFFAOYSA-N.
| Molecular formula | C23H31ClN4O3S |
|---|---|
| Molecular weight | 479.0 g/mol |
| IUPAC name | 3-[[(4-chlorophenyl)methyl-[(5-nitrothiophen-2-yl)methyl]amino]methyl]-N-pentylpyrrolidine-1-carboxamide |
| InChIKey | PPUYOYQTTWJTIU-UHFFFAOYSA-N |
| SMILES | CCCCCNC(=O)N1CCC(C1)CN(CC2=CC=C(C=C2)Cl)CC3=CC=C(S3)[N+](=O)[O-] |
Computed by PubChem (NCBI)