CAS 1204707-71-0 appears in our catalog under these names: SRT3109/ 99.89% (existing batch purity), SRT3109, AZD 5069, SRT3109 99%, SRT3109, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 10mM (in 1ml dmso), 100mg, 250mg.
N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-[[(2R,3R)-3,4-dihydroxybutan-2-yl]amino]pyrimidin-4-yl]azetidine-1-sulfonamide (CAS 1204707-71-0) is a chemical compound with the molecular formula C18H23F2N5O4S2 and a molecular weight of 475.5 g/mol. IUPAC name: N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-[[(2R,3R)-3,4-dihydroxybutan-2-yl]amino]pyrimidin-4-yl]azetidine-1-sulfonamide. InChIKey: QVKPEMXUBULFBM-RISCZKNCSA-N.
| Molecular formula | C18H23F2N5O4S2 |
|---|---|
| Molecular weight | 475.5 g/mol |
| IUPAC name | N-[2-[(2,3-difluorophenyl)methylsulfanyl]-6-[[(2R,3R)-3,4-dihydroxybutan-2-yl]amino]pyrimidin-4-yl]azetidine-1-sulfonamide |
| InChIKey | QVKPEMXUBULFBM-RISCZKNCSA-N |
| SMILES | C[C@H]([C@H](CO)O)NC1=CC(=NC(=N1)SCC2=C(C(=CC=C2)F)F)NS(=O)(=O)N3CCC3 |
Computed by PubChem (NCBI)