CAS 4749-61-5 appears in our catalog under these names: ST 91/ 99.64% (existing batch purity), ST 91, ST 91, N-(2,6-Diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine hydrochloride, 99%, 99%, ST91, 99.75%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 50 mg, 10mM/1mL.
N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine;hydrochloride (CAS 4749-61-5) is a chemical compound with the molecular formula C13H20ClN3 and a molecular weight of 253.77 g/mol. IUPAC name: N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine;hydrochloride. InChIKey: ZLRWFGBEDNTMEU-UHFFFAOYSA-N.
| Molecular formula | C13H20ClN3 |
|---|---|
| Molecular weight | 253.77 g/mol |
| IUPAC name | N-(2,6-diethylphenyl)-4,5-dihydro-1H-imidazol-2-amine;hydrochloride |
| InChIKey | ZLRWFGBEDNTMEU-UHFFFAOYSA-N |
| SMILES | CCC1=C(C(=CC=C1)CC)NC2=NCCN2.Cl |
Computed by PubChem (NCBI)