CAS 114727-43-4 appears in our catalog under these names: SU5201/ 97.85% (existing batch purity), NSC 247030, 3-(3,4-Dichlorobenzylidene)indolin-2-one, SU5201 99%, Su5201, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5 mg.
(3Z)-3-[(3,4-dichlorophenyl)methylidene]-1H-indol-2-one (CAS 114727-43-4) is a chemical compound with the molecular formula C15H9Cl2NO and a molecular weight of 290.1 g/mol. IUPAC name: (3Z)-3-[(3,4-dichlorophenyl)methylidene]-1H-indol-2-one. InChIKey: RCJZXLNWNCVIMJ-XFFZJAGNSA-N.
| Molecular formula | C15H9Cl2NO |
|---|---|
| Molecular weight | 290.1 g/mol |
| IUPAC name | (3Z)-3-[(3,4-dichlorophenyl)methylidene]-1H-indol-2-one |
| InChIKey | RCJZXLNWNCVIMJ-XFFZJAGNSA-N |
| SMILES | C1=CC=C2C(=C1)/C(=C/C3=CC(=C(C=C3)Cl)Cl)/C(=O)N2 |
Computed by PubChem (NCBI)