Products 704869-38-5
CAS 704869-38-5 appears in our catalog under these names: SUN11602, SUN11602/ 98.43% (existing batch purity), SUN11602, 98.00%. Offered by: GLPBio, TargetMol, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 50 mg, 10 mg.
4-[[4-[[2-(4-amino-2,3,5,6-tetramethylanilino)acetyl]-methylamino]piperidin-1-yl]methyl]benzamide (CAS 704869-38-5) is a chemical compound with the molecular formula C26H37N5O2 and a molecular weight of 451.6 g/mol. IUPAC name: 4-[[4-[[2-(4-amino-2,3,5,6-tetramethylanilino)acetyl]-methylamino]piperidin-1-yl]methyl]benzamide. InChIKey: KCODNOOPOPTZMO-UHFFFAOYSA-N.
| Molecular formula | C26H37N5O2 |
|---|---|
| Molecular weight | 451.6 g/mol |
| IUPAC name | 4-[[4-[[2-(4-amino-2,3,5,6-tetramethylanilino)acetyl]-methylamino]piperidin-1-yl]methyl]benzamide |
| InChIKey | KCODNOOPOPTZMO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1N)C)C)NCC(=O)N(C)C2CCN(CC2)CC3=CC=C(C=C3)C(=O)N)C |
Computed by PubChem (NCBI)