CAS 1384268-04-5 appears in our catalog under these names: SYP–5, SYP-5, SYP-5, 99.21%, SYP-5 (Standard), SYP-5/ 99.1% (existing batch purity). Offered by: GLPBio, Biosynth, MedChemExpress, TargetMol, Chemat. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 5mg, 50mg, 25mg, 5 mg, 50 mg.
(E)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)-3-thiophen-2-ylprop-2-en-1-one (CAS 1384268-04-5) is a chemical compound with the molecular formula C18H16O3S and a molecular weight of 312.4 g/mol. IUPAC name: (E)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)-3-thiophen-2-ylprop-2-en-1-one. InChIKey: OMVURDVBYIJCOI-FNORWQNLSA-N.
| Molecular formula | C18H16O3S |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (E)-1-(5-hydroxy-2,2-dimethylchromen-6-yl)-3-thiophen-2-ylprop-2-en-1-one |
| InChIKey | OMVURDVBYIJCOI-FNORWQNLSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC(=C2O)C(=O)/C=C/C3=CC=CS3)C |
Computed by PubChem (NCBI)