CAS 203787-91-1 appears in our catalog under these names: Salcaprozate Sodium, >95% (HPLC), Salcaprozate sodium, Salcaprozate sodium/ 99.75% (existing batch purity), Salcaprozate sodium, sodium 8-[(2-hydroxybenzoyl)amino]octanoate, 97%, 97%. Offered by: TRC, GLPBio, TargetMol, Biosynth, Chemat. Available pack sizes: 250mg, 500mg, 50mg, 1g, 5g, 2g, 10g, 25g.
Sodium 8-[(2-hydroxybenzoyl)amino]octanoate (CAS 203787-91-1) is a chemical compound with the molecular formula C15H20NNaO4 and a molecular weight of 301.31 g/mol. IUPAC name: sodium 8-[(2-hydroxybenzoyl)amino]octanoate. InChIKey: UOENJXXSKABLJL-UHFFFAOYSA-M.
| Molecular formula | C15H20NNaO4 |
|---|---|
| Molecular weight | 301.31 g/mol |
| IUPAC name | sodium 8-[(2-hydroxybenzoyl)amino]octanoate |
| InChIKey | UOENJXXSKABLJL-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)NCCCCCCCC(=O)[O-])O.[Na+] |
Computed by PubChem (NCBI)