cas: 1386874-06-1 — see every product listed under this CAS number, including other names
Samotolisib 98% (CAS 1386874-06-1) is a chemical reagent available from Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A173638-2mg |
| cas | 1386874-06-1 |
| size | 2mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 2mg | 320.31 Pln | |
| Ambeed | 5mg | 403.75 Pln | |
| Ambeed | 10mg | 659.62 Pln | |
| Ambeed | 25mg | 1182.50 Pln | |
| Ambeed | 50mg | 1877.81 Pln | |
| Ambeed | 100mg | 2956.94 Pln | |
| Ambeed | 250mg | 5421.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A173638 |
8-[5-(2-hydroxypropan-2-yl)-3-pyridinyl]-1-[(2S)-2-methoxypropyl]-3-methylimidazo[4,5-c]quinolin-2-one (CAS 1386874-06-1) is a chemical compound with the molecular formula C23H26N4O3 and a molecular weight of 406.5 g/mol. IUPAC name: 8-[5-(2-hydroxypropan-2-yl)-3-pyridinyl]-1-[(2S)-2-methoxypropyl]-3-methylimidazo[4,5-c]quinolin-2-one. InChIKey: ACCFLVVUVBJNGT-AWEZNQCLSA-N.
| Molecular formula | C23H26N4O3 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 8-[5-(2-hydroxypropan-2-yl)-3-pyridinyl]-1-[(2S)-2-methoxypropyl]-3-methylimidazo[4,5-c]quinolin-2-one |
| InChIKey | ACCFLVVUVBJNGT-AWEZNQCLSA-N |
| SMILES | C[C@@H](CN1C2=C3C=C(C=CC3=NC=C2N(C1=O)C)C4=CC(=CN=C4)C(C)(C)O)OC |
Computed by PubChem (NCBI)