CAS 1386874-06-1 appears in our catalog under these names: Ly3023414, 95%, LY3023414, Samotolisib/ 99.71% (existing batch purity), Samotolisib, Samotolisib 98%. Offered by: Combi-blocks, GLPBio, TargetMol, Biosynth, Ambeed. Available pack sizes: 100mg, 25mg, 5mg, 1mg, 2mg, 10mg, 50mg, 250mg.
8-[5-(2-hydroxypropan-2-yl)-3-pyridinyl]-1-[(2S)-2-methoxypropyl]-3-methylimidazo[4,5-c]quinolin-2-one (CAS 1386874-06-1) is a chemical compound with the molecular formula C23H26N4O3 and a molecular weight of 406.5 g/mol. IUPAC name: 8-[5-(2-hydroxypropan-2-yl)-3-pyridinyl]-1-[(2S)-2-methoxypropyl]-3-methylimidazo[4,5-c]quinolin-2-one. InChIKey: ACCFLVVUVBJNGT-AWEZNQCLSA-N.
| Molecular formula | C23H26N4O3 |
|---|---|
| Molecular weight | 406.5 g/mol |
| IUPAC name | 8-[5-(2-hydroxypropan-2-yl)-3-pyridinyl]-1-[(2S)-2-methoxypropyl]-3-methylimidazo[4,5-c]quinolin-2-one |
| InChIKey | ACCFLVVUVBJNGT-AWEZNQCLSA-N |
| SMILES | C[C@@H](CN1C2=C3C=C(C=CC3=NC=C2N(C1=O)C)C4=CC(=CN=C4)C(C)(C)O)OC |
Computed by PubChem (NCBI)