cas: 217477-25-3 — see every product listed under this CAS number, including other names
Sapienic acid (sodium) (CAS 217477-25-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12V7MZ-1mg |
| cas | 217477-25-3 |
| size | 1mg |
| availability | 0.5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 323.60 Pln | |
| Chemat | 2mg | 443.60 Pln | |
| Chemat | 5mg | 669.20 Pln | |
| Chemat | 10mg | 899.60 Pln | |
| Chemat | 25mg | 1768.40 Pln | |
| Chemat | 50mg | 2651.60 Pln | |
| Chemat | 100mg | 3789.20 Pln | |
| Chemat | 500mg | 7840.40 Pln |
| delivery time | 3 weeks |
|---|
Sodium (Z)-hexadec-6-enoate (CAS 217477-25-3) is a chemical compound with the molecular formula C16H29NaO2 and a molecular weight of 276.39 g/mol. IUPAC name: sodium (Z)-hexadec-6-enoate. InChIKey: MTXLIDQLSMYYRU-GMFCBQQYSA-M.
| Molecular formula | C16H29NaO2 |
|---|---|
| Molecular weight | 276.39 g/mol |
| IUPAC name | sodium (Z)-hexadec-6-enoate |
| InChIKey | MTXLIDQLSMYYRU-GMFCBQQYSA-M |
| SMILES | CCCCCCCCC/C=C\CCCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)