CAS 217477-25-3 appears in our catalog under these names: Sapienic acid sodium, Sapienic acid sodium/ 99.8% (existing batch purity), Sapienic acid (sodium), Sapienic acid (sodium), 98.0%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 2mg, 25mg, 50mg, 100mg, 500mg.
Sodium (Z)-hexadec-6-enoate (CAS 217477-25-3) is a chemical compound with the molecular formula C16H29NaO2 and a molecular weight of 276.39 g/mol. IUPAC name: sodium (Z)-hexadec-6-enoate. InChIKey: MTXLIDQLSMYYRU-GMFCBQQYSA-M.
| Molecular formula | C16H29NaO2 |
|---|---|
| Molecular weight | 276.39 g/mol |
| IUPAC name | sodium (Z)-hexadec-6-enoate |
| InChIKey | MTXLIDQLSMYYRU-GMFCBQQYSA-M |
| SMILES | CCCCCCCCC/C=C\CCCCC(=O)[O-].[Na+] |
Computed by PubChem (NCBI)