CAS 2098850-81-6 appears in our catalog under these names: Se-DMC/ 98.88% (existing batch purity), Se–DMC, Se-DMC, Se-DMC, 98.88%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 2mg, 25 mg, 5 mg, 10 mg.
Se-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 4-chlorobenzenecarboselenoate (CAS 2098850-81-6) is a chemical compound with the molecular formula C13H15ClO3Se and a molecular weight of 333.68 g/mol. IUPAC name: Se-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 4-chlorobenzenecarboselenoate. InChIKey: KURKEPPKABHBNC-UHFFFAOYSA-N.
| Molecular formula | C13H15ClO3Se |
|---|---|
| Molecular weight | 333.68 g/mol |
| IUPAC name | Se-[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl] 4-chlorobenzenecarboselenoate |
| InChIKey | KURKEPPKABHBNC-UHFFFAOYSA-N |
| SMILES | CC1(OCC(O1)C[Se]C(=O)C2=CC=C(C=C2)Cl)C |
Computed by PubChem (NCBI)