CAS 87729-89-3 appears in our catalog under these names: Seganserin/ 98.48% (existing batch purity), Seganserin, Seganserin, 99.30%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
3-[2-[4-[bis(4-fluorophenyl)methylidene]piperidin-1-yl]ethyl]-2-methylpyrido[1,2-a]pyrimidin-4-one (CAS 87729-89-3) is a chemical compound with the molecular formula C29H27F2N3O and a molecular weight of 471.5 g/mol. IUPAC name: 3-[2-[4-[bis(4-fluorophenyl)methylidene]piperidin-1-yl]ethyl]-2-methylpyrido[1,2-a]pyrimidin-4-one. InChIKey: ZGUPMFYFHHSNFK-UHFFFAOYSA-N.
| Molecular formula | C29H27F2N3O |
|---|---|
| Molecular weight | 471.5 g/mol |
| IUPAC name | 3-[2-[4-[bis(4-fluorophenyl)methylidene]piperidin-1-yl]ethyl]-2-methylpyrido[1,2-a]pyrimidin-4-one |
| InChIKey | ZGUPMFYFHHSNFK-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C=CC=CC2=N1)CCN3CCC(=C(C4=CC=C(C=C4)F)C5=CC=C(C=C5)F)CC3 |
Computed by PubChem (NCBI)