CAS 607-80-7 appears in our catalog under these names: Sesamin, Sesamin, >95% (HPLC), Sesamin/ 99.86% (existing batch purity), Sesamin, >98.0%(GC), Sesamin, 98.00%. Offered by: Dr. Ehrenstorfer, TRC, GLPBio, TargetMol, TCI. Available pack sizes: 25mg, 10mg, 1mg, 20mg, 10mM (in 1ml dmso), 5mg, 50mg, 100mg.
5-[(3S,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole (CAS 607-80-7) is a chemical compound with the molecular formula C20H18O6 and a molecular weight of 354.4 g/mol. IUPAC name: 5-[(3S,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole. InChIKey: PEYUIKBAABKQKQ-AFHBHXEDSA-N.
| Molecular formula | C20H18O6 |
|---|---|
| Molecular weight | 354.4 g/mol |
| IUPAC name | 5-[(3S,3aR,6S,6aR)-3-(1,3-benzodioxol-5-yl)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]-1,3-benzodioxole |
| InChIKey | PEYUIKBAABKQKQ-AFHBHXEDSA-N |
| SMILES | C1[C@H]2[C@H](CO[C@@H]2C3=CC4=C(C=C3)OCO4)[C@H](O1)C5=CC6=C(C=C5)OCO6 |
Computed by PubChem (NCBI)