CAS 1639220-17-9 appears in our catalog under these names: Sigma-1 receptor antagonist 3/ 100%, Sigma–1 receptor antagonist 3, 5-​Chloro-​2-​(4-​fluorophenyl)​-​4-​methyl-​6-​(3-​(1-​piperidinyl)​propoxy)​-pyrimidine, 5-Chloro-2-(4-fluorophenyl)-4-methyl-6-(3-(piperidin-1-yl)propoxy)pyrimidine, 98%, 98%, Sigma-1 receptor antagonist 3, 99.47%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 25 mg.
5-chloro-2-(4-fluorophenyl)-4-methyl-6-(3-piperidin-1-ylpropoxy)pyrimidine (CAS 1639220-17-9) is a chemical compound with the molecular formula C19H23ClFN3O and a molecular weight of 363.9 g/mol. IUPAC name: 5-chloro-2-(4-fluorophenyl)-4-methyl-6-(3-piperidin-1-ylpropoxy)pyrimidine. InChIKey: OAIHSWLLDNASTO-UHFFFAOYSA-N.
| Molecular formula | C19H23ClFN3O |
|---|---|
| Molecular weight | 363.9 g/mol |
| IUPAC name | 5-chloro-2-(4-fluorophenyl)-4-methyl-6-(3-piperidin-1-ylpropoxy)pyrimidine |
| InChIKey | OAIHSWLLDNASTO-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC(=N1)C2=CC=C(C=C2)F)OCCCN3CCCCC3)Cl |
Computed by PubChem (NCBI)