Siramesine hydrochloride
cas: 224177-60-0 — see every product listed under this CAS number, including other names
Siramesine hydrochloride (CAS 224177-60-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg. Offered by: TargetMol, GLPBio.
| brand | TargetMol |
|---|---|
| catalog number | T1885-1mg |
| cas | 224177-60-0 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| TargetMol | 1mg | 405.71 Pln | |
| TargetMol | 5mg | 624.84 Pln | |
| TargetMol | 10mg | 890.92 Pln | |
| TargetMol | 25mg | 1601.41 Pln | |
| TargetMol | 50mg | 2298.49 Pln | |
| TargetMol | 100mg | 3161.58 Pln | |
| TargetMol | 200mg | 4357.28 Pln | |
| GLPBio | 10mg | 1364.64 Pln | |
| GLPBio | 100mg | 4907.78 Pln | |
| GLPBio | 25mg | 2296.06 Pln | |
| GLPBio | 5mg | 1004.24 Pln | |
| GLPBio | 50mg | 3461.51 Pln |
properties
| purity | No data |
|---|---|
| delivery time | approx. 15 days |
1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]spiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride (CAS 224177-60-0) is a chemical compound with the molecular formula C30H32ClFN2O and a molecular weight of 491.0 g/mol. IUPAC name: 1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]spiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride. InChIKey: ILSRGIFRZZSGPN-UHFFFAOYSA-N.
| Molecular formula | C30H32ClFN2O |
|---|---|
| Molecular weight | 491.0 g/mol |
| IUPAC name | 1'-[4-[1-(4-fluorophenyl)indol-3-yl]butyl]spiro[1H-2-benzofuran-3,4'-piperidine];hydrochloride |
| InChIKey | ILSRGIFRZZSGPN-UHFFFAOYSA-N |
| SMILES | C1CN(CCC12C3=CC=CC=C3CO2)CCCCC4=CN(C5=CC=CC=C54)C6=CC=C(C=C6)F.Cl |
Computed by PubChem (NCBI)