CAS 2675-35-6 appears in our catalog under these names: Sivifene/ 99.24% (existing batch purity), Sivifene, Sivifene, 99.66%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 500mg.
4-[N-(2,4-dinitroanilino)-C-(4-hydroxyphenyl)carbonimidoyl]phenol (CAS 2675-35-6) is a chemical compound with the molecular formula C19H14N4O6 and a molecular weight of 394.3 g/mol. IUPAC name: 4-[N-(2,4-dinitroanilino)-C-(4-hydroxyphenyl)carbonimidoyl]phenol. InChIKey: YOQPCWIXYUNEET-UHFFFAOYSA-N.
| Molecular formula | C19H14N4O6 |
|---|---|
| Molecular weight | 394.3 g/mol |
| IUPAC name | 4-[N-(2,4-dinitroanilino)-C-(4-hydroxyphenyl)carbonimidoyl]phenol |
| InChIKey | YOQPCWIXYUNEET-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=NNC2=C(C=C(C=C2)[N+](=O)[O-])[N+](=O)[O-])C3=CC=C(C=C3)O)O |
Computed by PubChem (NCBI)