Sodium 2,3,4,5-tetrafluorobenzoate, 95%
cas: 67852-79-3 — see every product listed under this CAS number, including other names
Sodium 2,3,4,5-tetrafluorobenzoate, 95% (CAS 67852-79-3) is a chemical reagent available from Chemat. Available pack sizes: 25g, 50g, 100g, 250g, 500g, 1kg, 10g, 5g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F049941-25G |
| cas | 67852-79-3 |
| size | 25g |
| availability | In Stock Germany |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 195.78 Pln | |
| Fluorochem | 50g | 325.94 Pln | |
| Fluorochem | 100g | 393.63 Pln | |
| Fluorochem | 250g | 888.25 Pln | |
| Fluorochem | 500g | 1695.25 Pln | |
| Fluorochem | 1kg | 3304.06 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 259.12 Pln | |
| Ambeed | 100g | 387.06 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 98.00 Pln | |
| Chemat | 25g | 146.00 Pln | |
| Chemat | 100g | 395.60 Pln | |
| Chemat | 500g | 1761.60 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 5-10 days |
| category | Odczynniki chemiczne |
Sodium 2,3,4,5-tetrafluorobenzoate (CAS 67852-79-3) is a chemical compound with the molecular formula C7HF4NaO2 and a molecular weight of 216.06 g/mol. IUPAC name: sodium 2,3,4,5-tetrafluorobenzoate. InChIKey: PVMKPXIEIWFYDX-UHFFFAOYSA-M.
| Molecular formula | C7HF4NaO2 |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | sodium 2,3,4,5-tetrafluorobenzoate |
| InChIKey | PVMKPXIEIWFYDX-UHFFFAOYSA-M |
| SMILES | C1=C(C(=C(C(=C1F)F)F)F)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)