CAS 67852-79-3 appears in our catalog under these names: Sodium 2,3,4,5–tetrafluorobenzoate, Sodium 2,3,4,5-tetrafluorobenzoate, 95%, 95%, Sodium 2,3,4,5-tetrafluorobenzoate, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100g, 25g, 5g, 10g, 500g, 50g, 250g, 1kg.
Sodium 2,3,4,5-tetrafluorobenzoate (CAS 67852-79-3) is a chemical compound with the molecular formula C7HF4NaO2 and a molecular weight of 216.06 g/mol. IUPAC name: sodium 2,3,4,5-tetrafluorobenzoate. InChIKey: PVMKPXIEIWFYDX-UHFFFAOYSA-M.
| Molecular formula | C7HF4NaO2 |
|---|---|
| Molecular weight | 216.06 g/mol |
| IUPAC name | sodium 2,3,4,5-tetrafluorobenzoate |
| InChIKey | PVMKPXIEIWFYDX-UHFFFAOYSA-M |
| SMILES | C1=C(C(=C(C(=C1F)F)F)F)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)