cas: 3177-22-8 — see every product listed under this CAS number, including other names
Sodium 2,4-diaminobenzenesulfonate 97% (CAS 3177-22-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A911194-1g |
| cas | 3177-22-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 214.62 Pln | |
| Ambeed | 5g | 526.12 Pln | |
| Ambeed | 25g | 1560.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A911194 |
Sodium 2,4-diaminobenzenesulfonate (CAS 3177-22-8) is a chemical compound with the molecular formula C6H7N2NaO3S and a molecular weight of 210.19 g/mol. IUPAC name: sodium 2,4-diaminobenzenesulfonate. InChIKey: WYSWTEPAYPNWDV-UHFFFAOYSA-M.
| Molecular formula | C6H7N2NaO3S |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | sodium 2,4-diaminobenzenesulfonate |
| InChIKey | WYSWTEPAYPNWDV-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1N)N)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)