cas: 3177-22-8 — see every product listed under this CAS number, including other names
Sodium 2,4-diaminobenzenesulfonate, 98%, 98% (CAS 3177-22-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXN1-5g |
| cas | 3177-22-8 |
| size | 5g |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 112.40 Pln | |
| Chemat | 25g | 189.20 Pln | |
| Chemat | 500g | 1852.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Sodium 2,4-diaminobenzenesulfonate (CAS 3177-22-8) is a chemical compound with the molecular formula C6H7N2NaO3S and a molecular weight of 210.19 g/mol. IUPAC name: sodium 2,4-diaminobenzenesulfonate. InChIKey: WYSWTEPAYPNWDV-UHFFFAOYSA-M.
| Molecular formula | C6H7N2NaO3S |
|---|---|
| Molecular weight | 210.19 g/mol |
| IUPAC name | sodium 2,4-diaminobenzenesulfonate |
| InChIKey | WYSWTEPAYPNWDV-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1N)N)S(=O)(=O)[O-].[Na+] |
Computed by PubChem (NCBI)