Sodium 2-chlorobenzoate, 98%
cas: 17264-74-3 — see every product listed under this CAS number, including other names
Sodium 2-chlorobenzoate, 98% (CAS 17264-74-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11AP8H-100mg |
| cas | 17264-74-3 |
| size | 100mg |
| availability | 50g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 122.00 Pln | |
| Chemat | 250mg | 160.40 Pln | |
| Chemat | 1g | 256.40 Pln | |
| Chemat | 5g | 654.80 Pln | |
| Chemat | 10g | 1048.40 Pln | |
| Chemat | 25g | 2037.20 Pln | |
| Fluorochem | 1g | 320.74 Pln | |
| Fluorochem | 5g | 825.77 Pln | |
| Fluorochem | 10g | 1330.80 Pln | |
| Fluorochem | 25g | 2580.36 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Sodium 2-chlorobenzoate (CAS 17264-74-3) is a chemical compound with the molecular formula C7H4ClNaO2 and a molecular weight of 178.55 g/mol. IUPAC name: sodium 2-chlorobenzoate. InChIKey: OJLSABVGUWNJKD-UHFFFAOYSA-M.
| Molecular formula | C7H4ClNaO2 |
|---|---|
| Molecular weight | 178.55 g/mol |
| IUPAC name | sodium 2-chlorobenzoate |
| InChIKey | OJLSABVGUWNJKD-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C(=C1)C(=O)[O-])Cl.[Na+] |
Computed by PubChem (NCBI)