CAS 17264-88-9 appears in our catalog under these names: Sodium 3–chlorobenzoate, Sodium 3-chlorobenzoate, 95+%. Offered by: GLPBio, Fluorochem. Available pack sizes: 25g, 50g.
Sodium 3-chlorobenzoate (CAS 17264-88-9) is a chemical compound with the molecular formula C7H4ClNaO2 and a molecular weight of 178.55 g/mol. IUPAC name: sodium 3-chlorobenzoate. InChIKey: FUEXXBRYIMMSRF-UHFFFAOYSA-M.
| Molecular formula | C7H4ClNaO2 |
|---|---|
| Molecular weight | 178.55 g/mol |
| IUPAC name | sodium 3-chlorobenzoate |
| InChIKey | FUEXXBRYIMMSRF-UHFFFAOYSA-M |
| SMILES | C1=CC(=CC(=C1)Cl)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)