CAS 6362-79-4 appears in our catalog under these names: 5-Sulfoisophthalic acid sodium, 5–Sulfoisophthalic acid sodium salt, 5-Sulfoisophthalic acid monosodium salt, 95% , Monosodium 5-Sulfoisophthalate, >98.0%(T), Sodium 5-sulphoisophthalate. Offered by: Dr. Ehrenstorfer, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth. Available pack sizes: 250mg, 500g, 100g, 250g, 25g, 2,5g, 0,25g, 1000g.
Sodium 3,5-dicarboxybenzenesulfonate (CAS 6362-79-4) is a chemical compound with the molecular formula C8H5NaO7S and a molecular weight of 268.18 g/mol. IUPAC name: sodium 3,5-dicarboxybenzenesulfonate. InChIKey: YXTFRJVQOWZDPP-UHFFFAOYSA-M.
| Molecular formula | C8H5NaO7S |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | sodium 3,5-dicarboxybenzenesulfonate |
| InChIKey | YXTFRJVQOWZDPP-UHFFFAOYSA-M |
| SMILES | C1=C(C=C(C=C1C(=O)O)S(=O)(=O)[O-])C(=O)O.[Na+] |
Computed by PubChem (NCBI)