CAS 19089-60-2 appears in our catalog under these names: Monosodium 2–Sulfoterephthalate, 2-Sulphoterephthalic monosodium, Monosodium 2-sulfoterephthalate 98%, Monosodium 2-sulfoterephthalate, 99.96%, Monosodium 2-Sulfoterephthalate, 97%. Offered by: GLPBio, Biosynth, Ambeed, MedChemExpress, Fluorochem. Available pack sizes: 100g, 25g, 5g, 50g, 250g, 500g, 1g, 1 g.
Sodium 4-carboxy-2-sulfobenzoate (CAS 19089-60-2) is a chemical compound with the molecular formula C8H5NaO7S and a molecular weight of 268.18 g/mol. IUPAC name: sodium 4-carboxy-2-sulfobenzoate. InChIKey: JARIJYUQOKFVAJ-UHFFFAOYSA-M.
| Molecular formula | C8H5NaO7S |
|---|---|
| Molecular weight | 268.18 g/mol |
| IUPAC name | sodium 4-carboxy-2-sulfobenzoate |
| InChIKey | JARIJYUQOKFVAJ-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=C1C(=O)O)S(=O)(=O)O)C(=O)[O-].[Na+] |
Computed by PubChem (NCBI)