CAS 83949-45-5 is the registry number for Sodium 3-hydroxynaphthalene-2,6-disulfonate, 95%. Offered by: Ambeed. Available pack sizes: 1g, 5g, 25g.
Disodium;3-hydroxynaphthalene-2,6-disulfonate (CAS 83949-45-5) is a chemical compound with the molecular formula C10H6Na2O7S2 and a molecular weight of 348.3 g/mol. IUPAC name: disodium;3-hydroxynaphthalene-2,6-disulfonate. InChIKey: AHIGTETYWQNRQW-UHFFFAOYSA-L.
| Molecular formula | C10H6Na2O7S2 |
|---|---|
| Molecular weight | 348.3 g/mol |
| IUPAC name | disodium;3-hydroxynaphthalene-2,6-disulfonate |
| InChIKey | AHIGTETYWQNRQW-UHFFFAOYSA-L |
| SMILES | C1=CC(=CC2=CC(=C(C=C21)S(=O)(=O)[O-])O)S(=O)(=O)[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)