cas: 15898-43-8 — see every product listed under this CAS number, including other names
Sodium 4-Acetamidobenzenesulfinate Dihydrate, >98.0%(T) (CAS 15898-43-8) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | A0011-5G |
| cas | 15898-43-8 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 988.70 Pln | |
| TCI | 25g | 3407.99 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
Sodium 4-acetamidobenzenesulfinate (CAS 15898-43-8) is a chemical compound with the molecular formula C8H8NNaO3S and a molecular weight of 221.21 g/mol. IUPAC name: sodium 4-acetamidobenzenesulfinate. InChIKey: CPCFZBOTLAEGND-UHFFFAOYSA-M.
| Molecular formula | C8H8NNaO3S |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | sodium 4-acetamidobenzenesulfinate |
| InChIKey | CPCFZBOTLAEGND-UHFFFAOYSA-M |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)