cas: 15898-43-8 — see every product listed under this CAS number, including other names
Sodium 4-acetamidobenzenesulfinate, 95% (CAS 15898-43-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F317982-100MG |
| cas | 15898-43-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 253.05 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1158.98 Pln | |
| Fluorochem | 25g | 4183.96 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Sodium 4-acetamidobenzenesulfinate (CAS 15898-43-8) is a chemical compound with the molecular formula C8H8NNaO3S and a molecular weight of 221.21 g/mol. IUPAC name: sodium 4-acetamidobenzenesulfinate. InChIKey: CPCFZBOTLAEGND-UHFFFAOYSA-M.
| Molecular formula | C8H8NNaO3S |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | sodium 4-acetamidobenzenesulfinate |
| InChIKey | CPCFZBOTLAEGND-UHFFFAOYSA-M |
| SMILES | CC(=O)NC1=CC=C(C=C1)S(=O)[O-].[Na+] |
Computed by PubChem (NCBI)